About 6-[(5-chlorothiophen-2-yl)methyl-methylamino]imidazo[2,1-b][1,3]thiazole-5-carboxylic acid
6-[(5-chlorothiophen-2-yl)methyl-methylamino]imidazo[2,1-b][1,3]thiazole-5-carboxylic acid (PubChem CID 61442236) has the molecular formula C12H10ClN3O2S2
and a molecular weight of 327.82 g/mol. Its IUPAC name is 6-[(5-chlorothiophen-2-yl)methyl-methylamino]imidazo[2,1-b][1,3]thiazole-5-carboxylic acid.
Molecular Properties
| Compound Name | 6-[(5-chlorothiophen-2-yl)methyl-methylamino]imidazo[2,1-b][1,3]thiazole-5-carboxylic acid |
| PubChem CID | 61442236 |
| Molecular Formula | C12H10ClN3O2S2 |
| Molecular Weight | 327.82 g/mol |
| Exact Mass | 326.99 |
| IUPAC Name | 6-[(5-chlorothiophen-2-yl)methyl-methylamino]imidazo[2,1-b][1,3]thiazole-5-carboxylic acid |
| SMILES | CN(Cc1ccc(Cl)s1)c1nc2sccn2c1C(=O)O |
| InChI | InChI=1S/C12H10ClN3O2S2/c1-15(6-7-2-3-8(13)20-7)10-9(11(17)18)16-4-5-19-12(16)14-10/h2-5H,6H2,1H3,(H,17,18) |
| InChIKey | SFMDVRSHALXACN-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 57.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.82 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-[(5-chlorothiophen-2-yl)methyl-methylamino]imidazo[2,1-b][1,3]thiazole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(5-chlorothiophen-2-yl)methyl-methylamino]imidazo[2,1-b][1,3]thiazole-5-carboxylic acid?
The IUPAC name of 6-[(5-chlorothiophen-2-yl)methyl-methylamino]imidazo[2,1-b][1,3]thiazole-5-carboxylic acid (CID 61442236) is 6-[(5-chlorothiophen-2-yl)methyl-methylamino]imidazo[2,1-b][1,3]thiazole-5-carboxylic acid.
What is the SMILES notation for 6-[(5-chlorothiophen-2-yl)methyl-methylamino]imidazo[2,1-b][1,3]thiazole-5-carboxylic acid?
The canonical SMILES for 6-[(5-chlorothiophen-2-yl)methyl-methylamino]imidazo[2,1-b][1,3]thiazole-5-carboxylic acid is CN(Cc1ccc(Cl)s1)c1nc2sccn2c1C(=O)O.
What is the InChIKey of 6-[(5-chlorothiophen-2-yl)methyl-methylamino]imidazo[2,1-b][1,3]thiazole-5-carboxylic acid?
The InChIKey is SFMDVRSHALXACN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10ClN3O2S2/c1-15(6-7-2-3-8(13)20-7)10-9(11(17)18)16-4-5-19-12(16)14-10/h2-5H,6H2,1H3,(H,17,18).
What are the key properties of 6-[(5-chlorothiophen-2-yl)methyl-methylamino]imidazo[2,1-b][1,3]thiazole-5-carboxylic acid?
6-[(5-chlorothiophen-2-yl)methyl-methylamino]imidazo[2,1-b][1,3]thiazole-5-carboxylic acid has a molecular weight of 327.82 g/mol, XLogP of 3.45, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(5-chlorothiophen-2-yl)methyl-methylamino]imidazo[2,1-b][1,3]thiazole-5-carboxylic acid is sourced from PubChem (CID 61442236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).