C14H17ClN4S — CID 61442720
2-[(5-chlorothiophen-2-yl)methyl-methylamino]-4,6-dimethylpyridine-3-carboximidamide (PubChem CID 61442720) has the molecular formula C14H17ClN4S and a molecular weight of 308.84 g/mol. Its IUPAC name is 2-[(5-chlorothiophen-2-yl)methyl-methylamino]-4,6-dimethylpyridine-3-carboximidamide.
| Compound Name | 2-[(5-chlorothiophen-2-yl)methyl-methylamino]-4,6-dimethylpyridine-3-carboximidamide |
|---|---|
| PubChem CID | 61442720 |
| Molecular Formula | C14H17ClN4S |
| Molecular Weight | 308.84 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | 2-[(5-chlorothiophen-2-yl)methyl-methylamino]-4,6-dimethylpyridine-3-carboximidamide |
| SMILES | [H]/N=C(\N)c1c(C)cc(C)nc1N(C)Cc1ccc(Cl)s1 |
| InChI | InChI=1S/C14H17ClN4S/c1-8-6-9(2)18-14(12(8)13(16)17)19(3)7-10-4-5-11(15)20-10/h4-6H,7H2,1-3H3,(H3,16,17) |
| InChIKey | JRGJSKQIYXRYIT-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 66.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.84 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|