C19H15FN4O2S2 — CID 6144536
2-[(2E)-2-(1,3-benzothiazol-2-ylimino)-3-methyl-4-oxo-1,3-thiazolidin-5-yl]-N-(4-fluorophenyl)acetamide (PubChem CID 6144536) has the molecular formula C19H15FN4O2S2 and a molecular weight of 414.49 g/mol. Its IUPAC name is 2-[(2E)-2-(1,3-benzothiazol-2-ylimino)-3-methyl-4-oxo-1,3-thiazolidin-5-yl]-N-(4-fluorophenyl)acetamide.
| Compound Name | 2-[(2E)-2-(1,3-benzothiazol-2-ylimino)-3-methyl-4-oxo-1,3-thiazolidin-5-yl]-N-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 6144536 |
| Molecular Formula | C19H15FN4O2S2 |
| Molecular Weight | 414.49 g/mol |
| Exact Mass | 414.06 |
| IUPAC Name | 2-[(2E)-2-(1,3-benzothiazol-2-ylimino)-3-methyl-4-oxo-1,3-thiazolidin-5-yl]-N-(4-fluorophenyl)acetamide |
| SMILES | CN1C(=O)C(CC(=O)Nc2ccc(F)cc2)S/C1=N/c1nc2ccccc2s1 |
| InChI | InChI=1S/C19H15FN4O2S2/c1-24-17(26)15(10-16(25)21-12-8-6-11(20)7-9-12)28-19(24)23-18-22-13-4-2-3-5-14(13)27-18/h2-9,15H,10H2,1H3,(H,21,25)/b23-19+ |
| InChIKey | AXJLISADDRPJIU-FCDQGJHFSA-N |
| XLogP | 4.03 |
| TPSA | 74.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.49 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|