C14H21NO4S2 — CID 61454315
2-cyclohexyl-2-[(5-ethylthiophen-2-yl)sulfonylamino]acetic acid (PubChem CID 61454315) has the molecular formula C14H21NO4S2 and a molecular weight of 331.46 g/mol. Its IUPAC name is 2-cyclohexyl-2-[(5-ethylthiophen-2-yl)sulfonylamino]acetic acid.
| Compound Name | 2-cyclohexyl-2-[(5-ethylthiophen-2-yl)sulfonylamino]acetic acid |
|---|---|
| PubChem CID | 61454315 |
| Molecular Formula | C14H21NO4S2 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.09 |
| IUPAC Name | 2-cyclohexyl-2-[(5-ethylthiophen-2-yl)sulfonylamino]acetic acid |
| SMILES | CCc1ccc(S(=O)(=O)NC(C(=O)O)C2CCCCC2)s1 |
| InChI | InChI=1S/C14H21NO4S2/c1-2-11-8-9-12(20-11)21(18,19)15-13(14(16)17)10-6-4-3-5-7-10/h8-10,13,15H,2-7H2,1H3,(H,16,17) |
| InChIKey | FBJNWBIGLUGYAW-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |