C14H25ClN2O2S2 — CID 119983838
N-(2-amino-1-cyclohexylethyl)-5-ethylthiophene-2-sulfonamide;hydrochloride (PubChem CID 119983838) has the molecular formula C14H25ClN2O2S2 and a molecular weight of 352.95 g/mol. Its IUPAC name is N-(2-amino-1-cyclohexylethyl)-5-ethylthiophene-2-sulfonamide;hydrochloride.
| Compound Name | N-(2-amino-1-cyclohexylethyl)-5-ethylthiophene-2-sulfonamide;hydrochloride |
|---|---|
| PubChem CID | 119983838 |
| Molecular Formula | C14H25ClN2O2S2 |
| Molecular Weight | 352.95 g/mol |
| Exact Mass | 352.10 |
| IUPAC Name | N-(2-amino-1-cyclohexylethyl)-5-ethylthiophene-2-sulfonamide;hydrochloride |
| SMILES | CCc1ccc(S(=O)(=O)NC(CN)C2CCCCC2)s1.Cl |
| InChI | InChI=1S/C14H24N2O2S2.ClH/c1-2-12-8-9-14(19-12)20(17,18)16-13(10-15)11-6-4-3-5-7-11;/h8-9,11,13,16H,2-7,10,15H2,1H3;1H |
| InChIKey | QNZKOGSMVLZHJA-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.95 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |