C11H13NO6S — CID 61454859
3-(1-carboxyethylsulfonylamino)-2-methylbenzoic acid (PubChem CID 61454859) has the molecular formula C11H13NO6S and a molecular weight of 287.29 g/mol. Its IUPAC name is 3-(1-carboxyethylsulfonylamino)-2-methylbenzoic acid.
| Compound Name | 3-(1-carboxyethylsulfonylamino)-2-methylbenzoic acid |
|---|---|
| PubChem CID | 61454859 |
| Molecular Formula | C11H13NO6S |
| Molecular Weight | 287.29 g/mol |
| Exact Mass | 287.05 |
| IUPAC Name | 3-(1-carboxyethylsulfonylamino)-2-methylbenzoic acid |
| SMILES | Cc1c(NS(=O)(=O)C(C)C(=O)O)cccc1C(=O)O |
| InChI | InChI=1S/C11H13NO6S/c1-6-8(11(15)16)4-3-5-9(6)12-19(17,18)7(2)10(13)14/h3-5,7,12H,1-2H3,(H,13,14)(H,15,16) |
| InChIKey | BFLRKTVWIBDJMT-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.29 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |