C13H24N2O4S — CID 61457776
2-(1-azaspiro[5.5]undecan-4-ylsulfamoyl)propanoic acid (PubChem CID 61457776) has the molecular formula C13H24N2O4S and a molecular weight of 304.41 g/mol. Its IUPAC name is 2-(1-azaspiro[5.5]undecan-4-ylsulfamoyl)propanoic acid.
| Compound Name | 2-(1-azaspiro[5.5]undecan-4-ylsulfamoyl)propanoic acid |
|---|---|
| PubChem CID | 61457776 |
| Molecular Formula | C13H24N2O4S |
| Molecular Weight | 304.41 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | 2-(1-azaspiro[5.5]undecan-4-ylsulfamoyl)propanoic acid |
| SMILES | CC(C(=O)O)S(=O)(=O)NC1CCNC2(CCCCC2)C1 |
| InChI | InChI=1S/C13H24N2O4S/c1-10(12(16)17)20(18,19)15-11-5-8-14-13(9-11)6-3-2-4-7-13/h10-11,14-15H,2-9H2,1H3,(H,16,17) |
| InChIKey | SCYCFIUAXLAKFC-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.41 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |