C8H16N2O4S — CID 104982569
2-[[(3S)-piperidin-3-yl]sulfamoyl]propanoic acid (PubChem CID 104982569) has the molecular formula C8H16N2O4S and a molecular weight of 236.29 g/mol. Its IUPAC name is 2-[[(3S)-piperidin-3-yl]sulfamoyl]propanoic acid.
| Compound Name | 2-[[(3S)-piperidin-3-yl]sulfamoyl]propanoic acid |
|---|---|
| PubChem CID | 104982569 |
| Molecular Formula | C8H16N2O4S |
| Molecular Weight | 236.29 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | 2-[[(3S)-piperidin-3-yl]sulfamoyl]propanoic acid |
| SMILES | CC(C(=O)O)S(=O)(=O)N[C@H]1CCCNC1 |
| InChI | InChI=1S/C8H16N2O4S/c1-6(8(11)12)15(13,14)10-7-3-2-4-9-5-7/h6-7,9-10H,2-5H2,1H3,(H,11,12)/t6?,7-/m0/s1 |
| InChIKey | BTTRWOGJBRFDMZ-MLWJPKLSSA-N |
| XLogP | -0.87 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.29 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |