C13H13N5O2S — CID 61462636
4-nitro-N-(1-pyrazol-1-ylpropan-2-yl)-1,3-benzothiazol-5-amine (PubChem CID 61462636) has the molecular formula C13H13N5O2S and a molecular weight of 303.35 g/mol. Its IUPAC name is 4-nitro-N-(1-pyrazol-1-ylpropan-2-yl)-1,3-benzothiazol-5-amine.
| Compound Name | 4-nitro-N-(1-pyrazol-1-ylpropan-2-yl)-1,3-benzothiazol-5-amine |
|---|---|
| PubChem CID | 61462636 |
| Molecular Formula | C13H13N5O2S |
| Molecular Weight | 303.35 g/mol |
| Exact Mass | 303.08 |
| IUPAC Name | 4-nitro-N-(1-pyrazol-1-ylpropan-2-yl)-1,3-benzothiazol-5-amine |
| SMILES | CC(Cn1cccn1)Nc1ccc2scnc2c1[N+](=O)[O-] |
| InChI | InChI=1S/C13H13N5O2S/c1-9(7-17-6-2-5-15-17)16-10-3-4-11-12(14-8-21-11)13(10)18(19)20/h2-6,8-9,16H,7H2,1H3 |
| InChIKey | QPBBPWFDDBAQMV-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 85.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.35 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|