C14H19N3O2S — CID 63540396
N-heptan-2-yl-4-nitro-1,3-benzothiazol-5-amine (PubChem CID 63540396) has the molecular formula C14H19N3O2S and a molecular weight of 293.39 g/mol. Its IUPAC name is N-heptan-2-yl-4-nitro-1,3-benzothiazol-5-amine.
| Compound Name | N-heptan-2-yl-4-nitro-1,3-benzothiazol-5-amine |
|---|---|
| PubChem CID | 63540396 |
| Molecular Formula | C14H19N3O2S |
| Molecular Weight | 293.39 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | N-heptan-2-yl-4-nitro-1,3-benzothiazol-5-amine |
| SMILES | CCCCCC(C)Nc1ccc2scnc2c1[N+](=O)[O-] |
| InChI | InChI=1S/C14H19N3O2S/c1-3-4-5-6-10(2)16-11-7-8-12-13(15-9-20-12)14(11)17(18)19/h7-10,16H,3-6H2,1-2H3 |
| InChIKey | GFZOGRPBWKTTFL-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 68.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.39 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|