C12H17N3O4S — CID 61465520
6-[(4,5-dimethyl-1,3-thiazol-2-yl)carbamoylamino]-6-oxohexanoic acid (PubChem CID 61465520) has the molecular formula C12H17N3O4S and a molecular weight of 299.35 g/mol. Its IUPAC name is 6-[(4,5-dimethyl-1,3-thiazol-2-yl)carbamoylamino]-6-oxohexanoic acid.
| Compound Name | 6-[(4,5-dimethyl-1,3-thiazol-2-yl)carbamoylamino]-6-oxohexanoic acid |
|---|---|
| PubChem CID | 61465520 |
| Molecular Formula | C12H17N3O4S |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | 6-[(4,5-dimethyl-1,3-thiazol-2-yl)carbamoylamino]-6-oxohexanoic acid |
| SMILES | Cc1nc(NC(=O)NC(=O)CCCCC(=O)O)sc1C |
| InChI | InChI=1S/C12H17N3O4S/c1-7-8(2)20-12(13-7)15-11(19)14-9(16)5-3-4-6-10(17)18/h3-6H2,1-2H3,(H,17,18)(H2,13,14,15,16,19) |
| InChIKey | CIHAPMTZOMHEBA-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 108.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|