C14H19ClN2O2S — CID 61469465
1-butan-2-yl-3-[1-(5-chlorothiophen-2-yl)ethylamino]pyrrolidine-2,5-dione (PubChem CID 61469465) has the molecular formula C14H19ClN2O2S and a molecular weight of 314.84 g/mol. Its IUPAC name is 1-butan-2-yl-3-[1-(5-chlorothiophen-2-yl)ethylamino]pyrrolidine-2,5-dione.
| Compound Name | 1-butan-2-yl-3-[1-(5-chlorothiophen-2-yl)ethylamino]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 61469465 |
| Molecular Formula | C14H19ClN2O2S |
| Molecular Weight | 314.84 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | 1-butan-2-yl-3-[1-(5-chlorothiophen-2-yl)ethylamino]pyrrolidine-2,5-dione |
| SMILES | CCC(C)N1C(=O)CC(NC(C)c2ccc(Cl)s2)C1=O |
| InChI | InChI=1S/C14H19ClN2O2S/c1-4-8(2)17-13(18)7-10(14(17)19)16-9(3)11-5-6-12(15)20-11/h5-6,8-10,16H,4,7H2,1-3H3 |
| InChIKey | VLFNRUHCOXFTLK-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.84 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|