C14H14Cl2N2OS — CID 61469757
N-(4-chlorophenyl)-2-[1-(5-chlorothiophen-2-yl)ethylamino]acetamide (PubChem CID 61469757) has the molecular formula C14H14Cl2N2OS and a molecular weight of 329.25 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-[1-(5-chlorothiophen-2-yl)ethylamino]acetamide.
| Compound Name | N-(4-chlorophenyl)-2-[1-(5-chlorothiophen-2-yl)ethylamino]acetamide |
|---|---|
| PubChem CID | 61469757 |
| Molecular Formula | C14H14Cl2N2OS |
| Molecular Weight | 329.25 g/mol |
| Exact Mass | 328.02 |
| IUPAC Name | N-(4-chlorophenyl)-2-[1-(5-chlorothiophen-2-yl)ethylamino]acetamide |
| SMILES | CC(NCC(=O)Nc1ccc(Cl)cc1)c1ccc(Cl)s1 |
| InChI | InChI=1S/C14H14Cl2N2OS/c1-9(12-6-7-13(16)20-12)17-8-14(19)18-11-4-2-10(15)3-5-11/h2-7,9,17H,8H2,1H3,(H,18,19) |
| InChIKey | XRJKQWKXXZCMCM-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.25 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |