C11H14Br2N2 — CID 61474220
[1-(2,4-dibromophenyl)pyrrolidin-3-yl]methanamine (PubChem CID 61474220) has the molecular formula C11H14Br2N2 and a molecular weight of 334.06 g/mol. Its IUPAC name is [1-(2,4-dibromophenyl)pyrrolidin-3-yl]methanamine.
| Compound Name | [1-(2,4-dibromophenyl)pyrrolidin-3-yl]methanamine |
|---|---|
| PubChem CID | 61474220 |
| Molecular Formula | C11H14Br2N2 |
| Molecular Weight | 334.06 g/mol |
| Exact Mass | 331.95 |
| IUPAC Name | [1-(2,4-dibromophenyl)pyrrolidin-3-yl]methanamine |
| SMILES | NCC1CCN(c2ccc(Br)cc2Br)C1 |
| InChI | InChI=1S/C11H14Br2N2/c12-9-1-2-11(10(13)5-9)15-4-3-8(6-14)7-15/h1-2,5,8H,3-4,6-7,14H2 |
| InChIKey | BQTSJVVZFXTKSU-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.06 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |