C11H13BrClNO — CID 64863673
[1-(4-bromo-2-chlorophenyl)pyrrolidin-3-yl]methanol (PubChem CID 64863673) has the molecular formula C11H13BrClNO and a molecular weight of 290.59 g/mol. Its IUPAC name is [1-(4-bromo-2-chlorophenyl)pyrrolidin-3-yl]methanol.
| Compound Name | [1-(4-bromo-2-chlorophenyl)pyrrolidin-3-yl]methanol |
|---|---|
| PubChem CID | 64863673 |
| Molecular Formula | C11H13BrClNO |
| Molecular Weight | 290.59 g/mol |
| Exact Mass | 288.99 |
| IUPAC Name | [1-(4-bromo-2-chlorophenyl)pyrrolidin-3-yl]methanol |
| SMILES | OCC1CCN(c2ccc(Br)cc2Cl)C1 |
| InChI | InChI=1S/C11H13BrClNO/c12-9-1-2-11(10(13)5-9)14-4-3-8(6-14)7-15/h1-2,5,8,15H,3-4,6-7H2 |
| InChIKey | DFCBUUSTTPCELR-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.59 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |