C15H22BrClN2 — CID 62512586
N-[[1-(4-bromo-2-chlorophenyl)pyrrolidin-3-yl]methyl]-2-methylpropan-2-amine (PubChem CID 62512586) has the molecular formula C15H22BrClN2 and a molecular weight of 345.71 g/mol. Its IUPAC name is N-[[1-(4-bromo-2-chlorophenyl)pyrrolidin-3-yl]methyl]-2-methylpropan-2-amine.
| Compound Name | N-[[1-(4-bromo-2-chlorophenyl)pyrrolidin-3-yl]methyl]-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 62512586 |
| Molecular Formula | C15H22BrClN2 |
| Molecular Weight | 345.71 g/mol |
| Exact Mass | 344.07 |
| IUPAC Name | N-[[1-(4-bromo-2-chlorophenyl)pyrrolidin-3-yl]methyl]-2-methylpropan-2-amine |
| SMILES | CC(C)(C)NCC1CCN(c2ccc(Br)cc2Cl)C1 |
| InChI | InChI=1S/C15H22BrClN2/c1-15(2,3)18-9-11-6-7-19(10-11)14-5-4-12(16)8-13(14)17/h4-5,8,11,18H,6-7,9-10H2,1-3H3 |
| InChIKey | CFNFQUKVIUCCJD-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.71 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |