C16H16ClFN2S — CID 61477574
2-(2-chloroethyl)-5-fluoro-1-(1-thiophen-3-ylpropan-2-yl)benzimidazole (PubChem CID 61477574) has the molecular formula C16H16ClFN2S and a molecular weight of 322.84 g/mol. Its IUPAC name is 2-(2-chloroethyl)-5-fluoro-1-(1-thiophen-3-ylpropan-2-yl)benzimidazole.
| Compound Name | 2-(2-chloroethyl)-5-fluoro-1-(1-thiophen-3-ylpropan-2-yl)benzimidazole |
|---|---|
| PubChem CID | 61477574 |
| Molecular Formula | C16H16ClFN2S |
| Molecular Weight | 322.84 g/mol |
| Exact Mass | 322.07 |
| IUPAC Name | 2-(2-chloroethyl)-5-fluoro-1-(1-thiophen-3-ylpropan-2-yl)benzimidazole |
| SMILES | CC(Cc1ccsc1)n1c(CCCl)nc2cc(F)ccc21 |
| InChI | InChI=1S/C16H16ClFN2S/c1-11(8-12-5-7-21-10-12)20-15-3-2-13(18)9-14(15)19-16(20)4-6-17/h2-3,5,7,9-11H,4,6,8H2,1H3 |
| InChIKey | HQYLEORALQDOLW-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.84 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|