C16H17ClN2S — CID 62843335
2-(2-chloroethyl)-5-methyl-1-(1-thiophen-3-ylethyl)benzimidazole (PubChem CID 62843335) has the molecular formula C16H17ClN2S and a molecular weight of 304.85 g/mol. Its IUPAC name is 2-(2-chloroethyl)-5-methyl-1-(1-thiophen-3-ylethyl)benzimidazole.
| Compound Name | 2-(2-chloroethyl)-5-methyl-1-(1-thiophen-3-ylethyl)benzimidazole |
|---|---|
| PubChem CID | 62843335 |
| Molecular Formula | C16H17ClN2S |
| Molecular Weight | 304.85 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | 2-(2-chloroethyl)-5-methyl-1-(1-thiophen-3-ylethyl)benzimidazole |
| SMILES | Cc1ccc2c(c1)nc(CCCl)n2C(C)c1ccsc1 |
| InChI | InChI=1S/C16H17ClN2S/c1-11-3-4-15-14(9-11)18-16(5-7-17)19(15)12(2)13-6-8-20-10-13/h3-4,6,8-10,12H,5,7H2,1-2H3 |
| InChIKey | MJNUDYRHSIEQJD-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.85 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|