C8H15N5S — CID 61478158
1-(1-ethylpiperidin-3-yl)-2H-tetrazole-5-thione (PubChem CID 61478158) has the molecular formula C8H15N5S and a molecular weight of 213.31 g/mol. Its IUPAC name is 1-(1-ethylpiperidin-3-yl)-2H-tetrazole-5-thione.
| Compound Name | 1-(1-ethylpiperidin-3-yl)-2H-tetrazole-5-thione |
|---|---|
| PubChem CID | 61478158 |
| Molecular Formula | C8H15N5S |
| Molecular Weight | 213.31 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | 1-(1-ethylpiperidin-3-yl)-2H-tetrazole-5-thione |
| SMILES | CCN1CCCC(n2[nH]nnc2=S)C1 |
| InChI | InChI=1S/C8H15N5S/c1-2-12-5-3-4-7(6-12)13-8(14)9-10-11-13/h7H,2-6H2,1H3,(H,9,11,14) |
| InChIKey | KSQLIEJWHOWEHT-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 49.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.31 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|