C9H18N6S — CID 70534946
1-[3-(1-methylpiperazin-2-yl)propyl]-2H-tetrazole-5-thione (PubChem CID 70534946) has the molecular formula C9H18N6S and a molecular weight of 242.35 g/mol. Its IUPAC name is 1-[3-(1-methylpiperazin-2-yl)propyl]-2H-tetrazole-5-thione.
| Compound Name | 1-[3-(1-methylpiperazin-2-yl)propyl]-2H-tetrazole-5-thione |
|---|---|
| PubChem CID | 70534946 |
| Molecular Formula | C9H18N6S |
| Molecular Weight | 242.35 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | 1-[3-(1-methylpiperazin-2-yl)propyl]-2H-tetrazole-5-thione |
| SMILES | CN1CCNCC1CCCn1[nH]nnc1=S |
| InChI | InChI=1S/C9H18N6S/c1-14-6-4-10-7-8(14)3-2-5-15-9(16)11-12-13-15/h8,10H,2-7H2,1H3,(H,11,13,16) |
| InChIKey | RDQHTKNYWFJFHE-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.35 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|