C7H13N5S — CID 61221470
1-(1-methylpiperidin-3-yl)-2H-tetrazole-5-thione (PubChem CID 61221470) has the molecular formula C7H13N5S and a molecular weight of 199.28 g/mol. Its IUPAC name is 1-(1-methylpiperidin-3-yl)-2H-tetrazole-5-thione.
| Compound Name | 1-(1-methylpiperidin-3-yl)-2H-tetrazole-5-thione |
|---|---|
| PubChem CID | 61221470 |
| Molecular Formula | C7H13N5S |
| Molecular Weight | 199.28 g/mol |
| Exact Mass | 199.09 |
| IUPAC Name | 1-(1-methylpiperidin-3-yl)-2H-tetrazole-5-thione |
| SMILES | CN1CCCC(n2[nH]nnc2=S)C1 |
| InChI | InChI=1S/C7H13N5S/c1-11-4-2-3-6(5-11)12-7(13)8-9-10-12/h6H,2-5H2,1H3,(H,8,10,13) |
| InChIKey | XOHFUZDNKYWNIM-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 49.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.28 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|