C9H17N5S — CID 61499907
1-(1-piperidin-1-ylpropan-2-yl)-2H-tetrazole-5-thione (PubChem CID 61499907) has the molecular formula C9H17N5S and a molecular weight of 227.34 g/mol. Its IUPAC name is 1-(1-piperidin-1-ylpropan-2-yl)-2H-tetrazole-5-thione.
| Compound Name | 1-(1-piperidin-1-ylpropan-2-yl)-2H-tetrazole-5-thione |
|---|---|
| PubChem CID | 61499907 |
| Molecular Formula | C9H17N5S |
| Molecular Weight | 227.34 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | 1-(1-piperidin-1-ylpropan-2-yl)-2H-tetrazole-5-thione |
| SMILES | CC(CN1CCCCC1)n1[nH]nnc1=S |
| InChI | InChI=1S/C9H17N5S/c1-8(14-9(15)10-11-12-14)7-13-5-3-2-4-6-13/h8H,2-7H2,1H3,(H,10,12,15) |
| InChIKey | DDJRBXRYCJDYDQ-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 49.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.34 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|