C14H27N3O3 — CID 61478379
2-[(1-ethylpiperidin-3-yl)carbamoylamino]-3-methylpentanoic acid (PubChem CID 61478379) has the molecular formula C14H27N3O3 and a molecular weight of 285.39 g/mol. Its IUPAC name is 2-[(1-ethylpiperidin-3-yl)carbamoylamino]-3-methylpentanoic acid.
| Compound Name | 2-[(1-ethylpiperidin-3-yl)carbamoylamino]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 61478379 |
| Molecular Formula | C14H27N3O3 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.21 |
| IUPAC Name | 2-[(1-ethylpiperidin-3-yl)carbamoylamino]-3-methylpentanoic acid |
| SMILES | CCC(C)C(NC(=O)NC1CCCN(CC)C1)C(=O)O |
| InChI | InChI=1S/C14H27N3O3/c1-4-10(3)12(13(18)19)16-14(20)15-11-7-6-8-17(5-2)9-11/h10-12H,4-9H2,1-3H3,(H,18,19)(H2,15,16,20) |
| InChIKey | FKGQKMZPCHUTMB-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |