C8H13N3OS — CID 61480392
1-amino-3-[1-(5-methylfuran-2-yl)ethyl]thiourea (PubChem CID 61480392) has the molecular formula C8H13N3OS and a molecular weight of 199.28 g/mol. Its IUPAC name is 1-amino-3-[1-(5-methylfuran-2-yl)ethyl]thiourea.
| Compound Name | 1-amino-3-[1-(5-methylfuran-2-yl)ethyl]thiourea |
|---|---|
| PubChem CID | 61480392 |
| Molecular Formula | C8H13N3OS |
| Molecular Weight | 199.28 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | 1-amino-3-[1-(5-methylfuran-2-yl)ethyl]thiourea |
| SMILES | Cc1ccc(C(C)NC(=S)NN)o1 |
| InChI | InChI=1S/C8H13N3OS/c1-5-3-4-7(12-5)6(2)10-8(13)11-9/h3-4,6H,9H2,1-2H3,(H2,10,11,13) |
| InChIKey | BXMIQWWFDGIIKD-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 63.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.28 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|