C9H14N2O3 — CID 112672888
2-[1-(5-methylfuran-2-yl)ethylamino]oxyacetamide (PubChem CID 112672888) has the molecular formula C9H14N2O3 and a molecular weight of 198.22 g/mol. Its IUPAC name is 2-[1-(5-methylfuran-2-yl)ethylamino]oxyacetamide.
| Compound Name | 2-[1-(5-methylfuran-2-yl)ethylamino]oxyacetamide |
|---|---|
| PubChem CID | 112672888 |
| Molecular Formula | C9H14N2O3 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.10 |
| IUPAC Name | 2-[1-(5-methylfuran-2-yl)ethylamino]oxyacetamide |
| SMILES | Cc1ccc(C(C)NOCC(N)=O)o1 |
| InChI | InChI=1S/C9H14N2O3/c1-6-3-4-8(14-6)7(2)11-13-5-9(10)12/h3-4,7,11H,5H2,1-2H3,(H2,10,12) |
| InChIKey | KQIDZQACUMIZRE-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 77.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|