C10H14N2O5 — CID 103263647
methyl 5-[1-[(2-amino-2-oxoethoxy)amino]ethyl]furan-2-carboxylate (PubChem CID 103263647) has the molecular formula C10H14N2O5 and a molecular weight of 242.23 g/mol. Its IUPAC name is methyl 5-[1-[(2-amino-2-oxoethoxy)amino]ethyl]furan-2-carboxylate.
| Compound Name | methyl 5-[1-[(2-amino-2-oxoethoxy)amino]ethyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 103263647 |
| Molecular Formula | C10H14N2O5 |
| Molecular Weight | 242.23 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | methyl 5-[1-[(2-amino-2-oxoethoxy)amino]ethyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(C(C)NOCC(N)=O)o1 |
| InChI | InChI=1S/C10H14N2O5/c1-6(12-16-5-9(11)13)7-3-4-8(17-7)10(14)15-2/h3-4,6,12H,5H2,1-2H3,(H2,11,13) |
| InChIKey | CAVCFGOQLYBFOS-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 103.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.23 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|