C10H14N2O4 — CID 107711218
2-[1-(2,6-dihydroxyphenyl)ethylamino]oxyacetamide (PubChem CID 107711218) has the molecular formula C10H14N2O4 and a molecular weight of 226.23 g/mol. Its IUPAC name is 2-[1-(2,6-dihydroxyphenyl)ethylamino]oxyacetamide.
| Compound Name | 2-[1-(2,6-dihydroxyphenyl)ethylamino]oxyacetamide |
|---|---|
| PubChem CID | 107711218 |
| Molecular Formula | C10H14N2O4 |
| Molecular Weight | 226.23 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | 2-[1-(2,6-dihydroxyphenyl)ethylamino]oxyacetamide |
| SMILES | CC(NOCC(N)=O)c1c(O)cccc1O |
| InChI | InChI=1S/C10H14N2O4/c1-6(12-16-5-9(11)15)10-7(13)3-2-4-8(10)14/h2-4,6,12-14H,5H2,1H3,(H2,11,15) |
| InChIKey | HKBVDIXBXHZOCQ-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.23 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|