C10H12F2N2O2 — CID 112673156
2-[1-(2,5-difluorophenyl)ethylamino]oxyacetamide (PubChem CID 112673156) has the molecular formula C10H12F2N2O2 and a molecular weight of 230.21 g/mol. Its IUPAC name is 2-[1-(2,5-difluorophenyl)ethylamino]oxyacetamide.
| Compound Name | 2-[1-(2,5-difluorophenyl)ethylamino]oxyacetamide |
|---|---|
| PubChem CID | 112673156 |
| Molecular Formula | C10H12F2N2O2 |
| Molecular Weight | 230.21 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | 2-[1-(2,5-difluorophenyl)ethylamino]oxyacetamide |
| SMILES | CC(NOCC(N)=O)c1cc(F)ccc1F |
| InChI | InChI=1S/C10H12F2N2O2/c1-6(14-16-5-10(13)15)8-4-7(11)2-3-9(8)12/h2-4,6,14H,5H2,1H3,(H2,13,15) |
| InChIKey | ZGVBVBSLZLNWOB-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.21 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|