C18H21NO2 — CID 61482196
2-[N-[(2,5-dimethylphenyl)methyl]-4-methylanilino]acetic acid (PubChem CID 61482196) has the molecular formula C18H21NO2 and a molecular weight of 283.37 g/mol. Its IUPAC name is 2-[N-[(2,5-dimethylphenyl)methyl]-4-methylanilino]acetic acid.
| Compound Name | 2-[N-[(2,5-dimethylphenyl)methyl]-4-methylanilino]acetic acid |
|---|---|
| PubChem CID | 61482196 |
| Molecular Formula | C18H21NO2 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | 2-[N-[(2,5-dimethylphenyl)methyl]-4-methylanilino]acetic acid |
| SMILES | Cc1ccc(N(CC(=O)O)Cc2cc(C)ccc2C)cc1 |
| InChI | InChI=1S/C18H21NO2/c1-13-5-8-17(9-6-13)19(12-18(20)21)11-16-10-14(2)4-7-15(16)3/h4-10H,11-12H2,1-3H3,(H,20,21) |
| InChIKey | CJZTWKYYDSKAJG-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|