C14H14BrNO3S — CID 61484196
3-bromo-4-[(2-ethyl-1,3-thiazol-4-yl)methoxy]-5-methoxybenzaldehyde (PubChem CID 61484196) has the molecular formula C14H14BrNO3S and a molecular weight of 356.24 g/mol. Its IUPAC name is 3-bromo-4-[(2-ethyl-1,3-thiazol-4-yl)methoxy]-5-methoxybenzaldehyde.
| Compound Name | 3-bromo-4-[(2-ethyl-1,3-thiazol-4-yl)methoxy]-5-methoxybenzaldehyde |
|---|---|
| PubChem CID | 61484196 |
| Molecular Formula | C14H14BrNO3S |
| Molecular Weight | 356.24 g/mol |
| Exact Mass | 354.99 |
| IUPAC Name | 3-bromo-4-[(2-ethyl-1,3-thiazol-4-yl)methoxy]-5-methoxybenzaldehyde |
| SMILES | CCc1nc(COc2c(Br)cc(C=O)cc2OC)cs1 |
| InChI | InChI=1S/C14H14BrNO3S/c1-3-13-16-10(8-20-13)7-19-14-11(15)4-9(6-17)5-12(14)18-2/h4-6,8H,3,7H2,1-2H3 |
| InChIKey | OHXUEDYQIWHDFQ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.24 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|