C15H16ClNO3S — CID 61487588
3-chloro-5-methoxy-4-[(2-propyl-1,3-thiazol-4-yl)methoxy]benzaldehyde (PubChem CID 61487588) has the molecular formula C15H16ClNO3S and a molecular weight of 325.82 g/mol. Its IUPAC name is 3-chloro-5-methoxy-4-[(2-propyl-1,3-thiazol-4-yl)methoxy]benzaldehyde.
| Compound Name | 3-chloro-5-methoxy-4-[(2-propyl-1,3-thiazol-4-yl)methoxy]benzaldehyde |
|---|---|
| PubChem CID | 61487588 |
| Molecular Formula | C15H16ClNO3S |
| Molecular Weight | 325.82 g/mol |
| Exact Mass | 325.05 |
| IUPAC Name | 3-chloro-5-methoxy-4-[(2-propyl-1,3-thiazol-4-yl)methoxy]benzaldehyde |
| SMILES | CCCc1nc(COc2c(Cl)cc(C=O)cc2OC)cs1 |
| InChI | InChI=1S/C15H16ClNO3S/c1-3-4-14-17-11(9-21-14)8-20-15-12(16)5-10(7-18)6-13(15)19-2/h5-7,9H,3-4,8H2,1-2H3 |
| InChIKey | GEYRPHVSLULUDC-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.82 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|