C24H20BrClN2O4 — CID 6148647
(4E)-4-[(4-bromophenyl)-hydroxymethylidene]-1-(5-tert-butyl-1,2-oxazol-3-yl)-5-(4-chlorophenyl)pyrrolidine-2,3-dione (PubChem CID 6148647) has the molecular formula C24H20BrClN2O4 and a molecular weight of 515.79 g/mol. Its IUPAC name is (4E)-4-[(4-bromophenyl)-hydroxymethylidene]-1-(5-tert-butyl-1,2-oxazol-3-yl)-5-(4-chlorophenyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[(4-bromophenyl)-hydroxymethylidene]-1-(5-tert-butyl-1,2-oxazol-3-yl)-5-(4-chlorophenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 6148647 |
| Molecular Formula | C24H20BrClN2O4 |
| Molecular Weight | 515.79 g/mol |
| Exact Mass | 514.03 |
| IUPAC Name | (4E)-4-[(4-bromophenyl)-hydroxymethylidene]-1-(5-tert-butyl-1,2-oxazol-3-yl)-5-(4-chlorophenyl)pyrrolidine-2,3-dione |
| SMILES | CC(C)(C)c1cc(N2C(=O)C(=O)/C(=C(/O)c3ccc(Br)cc3)C2c2ccc(Cl)cc2)no1 |
| InChI | InChI=1S/C24H20BrClN2O4/c1-24(2,3)17-12-18(27-32-17)28-20(13-6-10-16(26)11-7-13)19(22(30)23(28)31)21(29)14-4-8-15(25)9-5-14/h4-12,20,29H,1-3H3/b21-19+ |
| InChIKey | UHKBEPRQMGRAAM-XUTLUUPISA-N |
| XLogP | 6.01 |
| TPSA | 83.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.79 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|