C28H24ClN3O7 — CID 162306186
(Z)-4-[3-[[1-(5-tert-butyl-1,2-oxazol-3-yl)-2-(4-chlorophenyl)-4,5-dioxopyrrolidin-3-ylidene]-hydroxymethyl]anilino]-4-oxobut-2-enoic acid (PubChem CID 162306186) has the molecular formula C28H24ClN3O7 and a molecular weight of 549.97 g/mol. Its IUPAC name is (Z)-4-[3-[[1-(5-tert-butyl-1,2-oxazol-3-yl)-2-(4-chlorophenyl)-4,5-dioxopyrrolidin-3-ylidene]-hydroxymethyl]anilino]-4-oxobut-2-enoic acid.
| Compound Name | (Z)-4-[3-[[1-(5-tert-butyl-1,2-oxazol-3-yl)-2-(4-chlorophenyl)-4,5-dioxopyrrolidin-3-ylidene]-hydroxymethyl]anilino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 162306186 |
| Molecular Formula | C28H24ClN3O7 |
| Molecular Weight | 549.97 g/mol |
| Exact Mass | 549.13 |
| IUPAC Name | (Z)-4-[3-[[1-(5-tert-butyl-1,2-oxazol-3-yl)-2-(4-chlorophenyl)-4,5-dioxopyrrolidin-3-ylidene]-hydroxymethyl]anilino]-4-oxobut-2-enoic acid |
| SMILES | CC(C)(C)c1cc(N2C(=O)C(=O)C(=C(O)c3cccc(NC(=O)/C=C\C(=O)O)c3)C2c2ccc(Cl)cc2)no1 |
| InChI | InChI=1S/C28H24ClN3O7/c1-28(2,3)19-14-20(31-39-19)32-24(15-7-9-17(29)10-8-15)23(26(37)27(32)38)25(36)16-5-4-6-18(13-16)30-21(33)11-12-22(34)35/h4-14,24,36H,1-3H3,(H,30,33)(H,34,35)/b12-11-,25-23? |
| InChIKey | PRFXBVADYOXXLO-CNIPLEIVSA-N |
| XLogP | 4.83 |
| TPSA | 150.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.97 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|