C10H19NO4S — CID 61489147
3-[2-(3-methylbutan-2-ylamino)-2-oxoethyl]sulfinylpropanoic acid (PubChem CID 61489147) has the molecular formula C10H19NO4S and a molecular weight of 249.33 g/mol. Its IUPAC name is 3-[2-(3-methylbutan-2-ylamino)-2-oxoethyl]sulfinylpropanoic acid.
| Compound Name | 3-[2-(3-methylbutan-2-ylamino)-2-oxoethyl]sulfinylpropanoic acid |
|---|---|
| PubChem CID | 61489147 |
| Molecular Formula | C10H19NO4S |
| Molecular Weight | 249.33 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | 3-[2-(3-methylbutan-2-ylamino)-2-oxoethyl]sulfinylpropanoic acid |
| SMILES | CC(C)C(C)NC(=O)CS(=O)CCC(=O)O |
| InChI | InChI=1S/C10H19NO4S/c1-7(2)8(3)11-9(12)6-16(15)5-4-10(13)14/h7-8H,4-6H2,1-3H3,(H,11,12)(H,13,14) |
| InChIKey | HAUPXKTZENPKNF-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.33 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |