C12H23NO3S — CID 64640143
2-butylsulfinyl-N-(2-methyl-4-oxopentan-3-yl)acetamide (PubChem CID 64640143) has the molecular formula C12H23NO3S and a molecular weight of 261.39 g/mol. Its IUPAC name is 2-butylsulfinyl-N-(2-methyl-4-oxopentan-3-yl)acetamide.
| Compound Name | 2-butylsulfinyl-N-(2-methyl-4-oxopentan-3-yl)acetamide |
|---|---|
| PubChem CID | 64640143 |
| Molecular Formula | C12H23NO3S |
| Molecular Weight | 261.39 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | 2-butylsulfinyl-N-(2-methyl-4-oxopentan-3-yl)acetamide |
| SMILES | CCCCS(=O)CC(=O)NC(C(C)=O)C(C)C |
| InChI | InChI=1S/C12H23NO3S/c1-5-6-7-17(16)8-11(15)13-12(9(2)3)10(4)14/h9,12H,5-8H2,1-4H3,(H,13,15) |
| InChIKey | FNVBVEWWKUXPIM-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.39 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |