C13H18F3NO3 — CID 61490558
2-[5-methoxy-2-[2-(2,2,2-trifluoroethoxy)ethoxy]phenyl]ethanamine (PubChem CID 61490558) has the molecular formula C13H18F3NO3 and a molecular weight of 293.29 g/mol. Its IUPAC name is 2-[5-methoxy-2-[2-(2,2,2-trifluoroethoxy)ethoxy]phenyl]ethanamine.
| Compound Name | 2-[5-methoxy-2-[2-(2,2,2-trifluoroethoxy)ethoxy]phenyl]ethanamine |
|---|---|
| PubChem CID | 61490558 |
| Molecular Formula | C13H18F3NO3 |
| Molecular Weight | 293.29 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | 2-[5-methoxy-2-[2-(2,2,2-trifluoroethoxy)ethoxy]phenyl]ethanamine |
| SMILES | COc1ccc(OCCOCC(F)(F)F)c(CCN)c1 |
| InChI | InChI=1S/C13H18F3NO3/c1-18-11-2-3-12(10(8-11)4-5-17)20-7-6-19-9-13(14,15)16/h2-3,8H,4-7,9,17H2,1H3 |
| InChIKey | OAMDJHDFBMUDJX-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.29 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|