C13H25F3N2O — CID 61491073
N'-cyclopentyl-N'-[3-(2,2,2-trifluoroethoxy)propyl]propane-1,3-diamine (PubChem CID 61491073) has the molecular formula C13H25F3N2O and a molecular weight of 282.35 g/mol. Its IUPAC name is N'-cyclopentyl-N'-[3-(2,2,2-trifluoroethoxy)propyl]propane-1,3-diamine.
| Compound Name | N'-cyclopentyl-N'-[3-(2,2,2-trifluoroethoxy)propyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 61491073 |
| Molecular Formula | C13H25F3N2O |
| Molecular Weight | 282.35 g/mol |
| Exact Mass | 282.19 |
| IUPAC Name | N'-cyclopentyl-N'-[3-(2,2,2-trifluoroethoxy)propyl]propane-1,3-diamine |
| SMILES | NCCCN(CCCOCC(F)(F)F)C1CCCC1 |
| InChI | InChI=1S/C13H25F3N2O/c14-13(15,16)11-19-10-4-9-18(8-3-7-17)12-5-1-2-6-12/h12H,1-11,17H2 |
| InChIKey | LQFRUJURQINIPE-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.35 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|