C13H15ClF3NO3 — CID 61491179
2-[3-chloro-N-[3-(2,2,2-trifluoroethoxy)propyl]anilino]acetic acid (PubChem CID 61491179) has the molecular formula C13H15ClF3NO3 and a molecular weight of 325.71 g/mol. Its IUPAC name is 2-[3-chloro-N-[3-(2,2,2-trifluoroethoxy)propyl]anilino]acetic acid.
| Compound Name | 2-[3-chloro-N-[3-(2,2,2-trifluoroethoxy)propyl]anilino]acetic acid |
|---|---|
| PubChem CID | 61491179 |
| Molecular Formula | C13H15ClF3NO3 |
| Molecular Weight | 325.71 g/mol |
| Exact Mass | 325.07 |
| IUPAC Name | 2-[3-chloro-N-[3-(2,2,2-trifluoroethoxy)propyl]anilino]acetic acid |
| SMILES | O=C(O)CN(CCCOCC(F)(F)F)c1cccc(Cl)c1 |
| InChI | InChI=1S/C13H15ClF3NO3/c14-10-3-1-4-11(7-10)18(8-12(19)20)5-2-6-21-9-13(15,16)17/h1,3-4,7H,2,5-6,8-9H2,(H,19,20) |
| InChIKey | WTLOHGRHONNAGU-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.71 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|