C14H28F3N3O — CID 61491188
2-methyl-3-[4-[3-(2,2,2-trifluoroethoxy)propyl]-1,4-diazepan-1-yl]propan-1-amine (PubChem CID 61491188) has the molecular formula C14H28F3N3O and a molecular weight of 311.39 g/mol. Its IUPAC name is 2-methyl-3-[4-[3-(2,2,2-trifluoroethoxy)propyl]-1,4-diazepan-1-yl]propan-1-amine.
| Compound Name | 2-methyl-3-[4-[3-(2,2,2-trifluoroethoxy)propyl]-1,4-diazepan-1-yl]propan-1-amine |
|---|---|
| PubChem CID | 61491188 |
| Molecular Formula | C14H28F3N3O |
| Molecular Weight | 311.39 g/mol |
| Exact Mass | 311.22 |
| IUPAC Name | 2-methyl-3-[4-[3-(2,2,2-trifluoroethoxy)propyl]-1,4-diazepan-1-yl]propan-1-amine |
| SMILES | CC(CN)CN1CCCN(CCCOCC(F)(F)F)CC1 |
| InChI | InChI=1S/C14H28F3N3O/c1-13(10-18)11-20-5-2-4-19(7-8-20)6-3-9-21-12-14(15,16)17/h13H,2-12,18H2,1H3 |
| InChIKey | WHQHKAKLBROIRG-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 41.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.39 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|