C13H22F3N3O — CID 63339270
2-[4-[3-(2,2,2-trifluoroethoxy)propyl]piperazin-1-yl]butanenitrile (PubChem CID 63339270) has the molecular formula C13H22F3N3O and a molecular weight of 293.33 g/mol. Its IUPAC name is 2-[4-[3-(2,2,2-trifluoroethoxy)propyl]piperazin-1-yl]butanenitrile.
| Compound Name | 2-[4-[3-(2,2,2-trifluoroethoxy)propyl]piperazin-1-yl]butanenitrile |
|---|---|
| PubChem CID | 63339270 |
| Molecular Formula | C13H22F3N3O |
| Molecular Weight | 293.33 g/mol |
| Exact Mass | 293.17 |
| IUPAC Name | 2-[4-[3-(2,2,2-trifluoroethoxy)propyl]piperazin-1-yl]butanenitrile |
| SMILES | CCC(C#N)N1CCN(CCCOCC(F)(F)F)CC1 |
| InChI | InChI=1S/C13H22F3N3O/c1-2-12(10-17)19-7-5-18(6-8-19)4-3-9-20-11-13(14,15)16/h12H,2-9,11H2,1H3 |
| InChIKey | OYIUTEVJKBMLTE-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 39.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.33 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|