C15H29ClF3N3O2 — CID 119752100
(2S)-2-amino-3,3-dimethyl-1-[4-[3-(2,2,2-trifluoroethoxy)propyl]piperazin-1-yl]butan-1-one;hydrochloride (PubChem CID 119752100) has the molecular formula C15H29ClF3N3O2 and a molecular weight of 375.86 g/mol. Its IUPAC name is (2S)-2-amino-3,3-dimethyl-1-[4-[3-(2,2,2-trifluoroethoxy)propyl]piperazin-1-yl]butan-1-one;hydrochloride.
| Compound Name | (2S)-2-amino-3,3-dimethyl-1-[4-[3-(2,2,2-trifluoroethoxy)propyl]piperazin-1-yl]butan-1-one;hydrochloride |
|---|---|
| PubChem CID | 119752100 |
| Molecular Formula | C15H29ClF3N3O2 |
| Molecular Weight | 375.86 g/mol |
| Exact Mass | 375.19 |
| IUPAC Name | (2S)-2-amino-3,3-dimethyl-1-[4-[3-(2,2,2-trifluoroethoxy)propyl]piperazin-1-yl]butan-1-one;hydrochloride |
| SMILES | CC(C)(C)[C@H](N)C(=O)N1CCN(CCCOCC(F)(F)F)CC1.Cl |
| InChI | InChI=1S/C15H28F3N3O2.ClH/c1-14(2,3)12(19)13(22)21-8-6-20(7-9-21)5-4-10-23-11-15(16,17)18;/h12H,4-11,19H2,1-3H3;1H/t12-;/m1./s1 |
| InChIKey | HQMVZYSCGPCQAB-UTONKHPSSA-N |
| XLogP | 1.89 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.86 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|