C20H29F3N2O2 — CID 86846924
[4-(2-methylpropyl)phenyl]-[4-[3-(2,2,2-trifluoroethoxy)propyl]piperazin-1-yl]methanone (PubChem CID 86846924) has the molecular formula C20H29F3N2O2 and a molecular weight of 386.46 g/mol. Its IUPAC name is [4-(2-methylpropyl)phenyl]-[4-[3-(2,2,2-trifluoroethoxy)propyl]piperazin-1-yl]methanone.
| Compound Name | [4-(2-methylpropyl)phenyl]-[4-[3-(2,2,2-trifluoroethoxy)propyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 86846924 |
| Molecular Formula | C20H29F3N2O2 |
| Molecular Weight | 386.46 g/mol |
| Exact Mass | 386.22 |
| IUPAC Name | [4-(2-methylpropyl)phenyl]-[4-[3-(2,2,2-trifluoroethoxy)propyl]piperazin-1-yl]methanone |
| SMILES | CC(C)Cc1ccc(C(=O)N2CCN(CCCOCC(F)(F)F)CC2)cc1 |
| InChI | InChI=1S/C20H29F3N2O2/c1-16(2)14-17-4-6-18(7-5-17)19(26)25-11-9-24(10-12-25)8-3-13-27-15-20(21,22)23/h4-7,16H,3,8-15H2,1-2H3 |
| InChIKey | XETSOAHBDNHSCW-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.46 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|