C24H40N2O3 — CID 170359804
[4-(2-methylpropoxymethyl)phenyl]-[4-(5-propan-2-yloxypentyl)piperazin-1-yl]methanone (PubChem CID 170359804) has the molecular formula C24H40N2O3 and a molecular weight of 404.60 g/mol. Its IUPAC name is [4-(2-methylpropoxymethyl)phenyl]-[4-(5-propan-2-yloxypentyl)piperazin-1-yl]methanone.
| Compound Name | [4-(2-methylpropoxymethyl)phenyl]-[4-(5-propan-2-yloxypentyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 170359804 |
| Molecular Formula | C24H40N2O3 |
| Molecular Weight | 404.60 g/mol |
| Exact Mass | 404.30 |
| IUPAC Name | [4-(2-methylpropoxymethyl)phenyl]-[4-(5-propan-2-yloxypentyl)piperazin-1-yl]methanone |
| SMILES | CC(C)COCc1ccc(C(=O)N2CCN(CCCCCOC(C)C)CC2)cc1 |
| InChI | InChI=1S/C24H40N2O3/c1-20(2)18-28-19-22-8-10-23(11-9-22)24(27)26-15-13-25(14-16-26)12-6-5-7-17-29-21(3)4/h8-11,20-21H,5-7,12-19H2,1-4H3 |
| InChIKey | FCHJXNIYNYNQQI-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.60 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|