C12H22F3N3O2 — CID 61491632
2-[methyl-[3-(2,2,2-trifluoroethoxy)propyl]amino]-1-piperazin-1-ylethanone (PubChem CID 61491632) has the molecular formula C12H22F3N3O2 and a molecular weight of 297.32 g/mol. Its IUPAC name is 2-[methyl-[3-(2,2,2-trifluoroethoxy)propyl]amino]-1-piperazin-1-ylethanone.
| Compound Name | 2-[methyl-[3-(2,2,2-trifluoroethoxy)propyl]amino]-1-piperazin-1-ylethanone |
|---|---|
| PubChem CID | 61491632 |
| Molecular Formula | C12H22F3N3O2 |
| Molecular Weight | 297.32 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | 2-[methyl-[3-(2,2,2-trifluoroethoxy)propyl]amino]-1-piperazin-1-ylethanone |
| SMILES | CN(CCCOCC(F)(F)F)CC(=O)N1CCNCC1 |
| InChI | InChI=1S/C12H22F3N3O2/c1-17(5-2-8-20-10-12(13,14)15)9-11(19)18-6-3-16-4-7-18/h16H,2-10H2,1H3 |
| InChIKey | ZAJPQUGPTRANER-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.32 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|