C12H9Cl3O2 — CID 614929
5,7-dimethyl-2-(trichloromethyl)chromen-4-one (PubChem CID 614929) has the molecular formula C12H9Cl3O2 and a molecular weight of 291.56 g/mol. Its IUPAC name is 5,7-dimethyl-2-(trichloromethyl)chromen-4-one.
| Compound Name | 5,7-dimethyl-2-(trichloromethyl)chromen-4-one |
|---|---|
| PubChem CID | 614929 |
| Molecular Formula | C12H9Cl3O2 |
| Molecular Weight | 291.56 g/mol |
| Exact Mass | 289.97 |
| IUPAC Name | 5,7-dimethyl-2-(trichloromethyl)chromen-4-one |
| SMILES | Cc1cc(C)c2c(=O)cc(C(Cl)(Cl)Cl)oc2c1 |
| InChI | InChI=1S/C12H9Cl3O2/c1-6-3-7(2)11-8(16)5-10(12(13,14)15)17-9(11)4-6/h3-5H,1-2H3 |
| InChIKey | LKBZJIIRGBURFC-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.56 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|