C13H14Cl2N2O2 — CID 61493875
[3,5-dichloro-2-[2-(2-methylimidazol-1-yl)ethoxy]phenyl]methanol (PubChem CID 61493875) has the molecular formula C13H14Cl2N2O2 and a molecular weight of 301.17 g/mol. Its IUPAC name is [3,5-dichloro-2-[2-(2-methylimidazol-1-yl)ethoxy]phenyl]methanol.
| Compound Name | [3,5-dichloro-2-[2-(2-methylimidazol-1-yl)ethoxy]phenyl]methanol |
|---|---|
| PubChem CID | 61493875 |
| Molecular Formula | C13H14Cl2N2O2 |
| Molecular Weight | 301.17 g/mol |
| Exact Mass | 300.04 |
| IUPAC Name | [3,5-dichloro-2-[2-(2-methylimidazol-1-yl)ethoxy]phenyl]methanol |
| SMILES | Cc1nccn1CCOc1c(Cl)cc(Cl)cc1CO |
| InChI | InChI=1S/C13H14Cl2N2O2/c1-9-16-2-3-17(9)4-5-19-13-10(8-18)6-11(14)7-12(13)15/h2-3,6-7,18H,4-5,8H2,1H3 |
| InChIKey | OPEOIWGNLOGEOL-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.17 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |