C14H18N4O3 — CID 61494997
1-[4-(3-imidazol-1-ylpropoxy)-3-nitrophenyl]-N-methylmethanamine (PubChem CID 61494997) has the molecular formula C14H18N4O3 and a molecular weight of 290.32 g/mol. Its IUPAC name is 1-[4-(3-imidazol-1-ylpropoxy)-3-nitrophenyl]-N-methylmethanamine.
| Compound Name | 1-[4-(3-imidazol-1-ylpropoxy)-3-nitrophenyl]-N-methylmethanamine |
|---|---|
| PubChem CID | 61494997 |
| Molecular Formula | C14H18N4O3 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | 1-[4-(3-imidazol-1-ylpropoxy)-3-nitrophenyl]-N-methylmethanamine |
| SMILES | CNCc1ccc(OCCCn2ccnc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H18N4O3/c1-15-10-12-3-4-14(13(9-12)18(19)20)21-8-2-6-17-7-5-16-11-17/h3-5,7,9,11,15H,2,6,8,10H2,1H3 |
| InChIKey | MQHWKHCHHPNXBS-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 82.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|