C9H13F2N3O2 — CID 61499596
methyl 2-[[1-(difluoromethyl)imidazol-2-yl]methylamino]propanoate (PubChem CID 61499596) has the molecular formula C9H13F2N3O2 and a molecular weight of 233.22 g/mol. Its IUPAC name is methyl 2-[[1-(difluoromethyl)imidazol-2-yl]methylamino]propanoate.
| Compound Name | methyl 2-[[1-(difluoromethyl)imidazol-2-yl]methylamino]propanoate |
|---|---|
| PubChem CID | 61499596 |
| Molecular Formula | C9H13F2N3O2 |
| Molecular Weight | 233.22 g/mol |
| Exact Mass | 233.10 |
| IUPAC Name | methyl 2-[[1-(difluoromethyl)imidazol-2-yl]methylamino]propanoate |
| SMILES | COC(=O)C(C)NCc1nccn1C(F)F |
| InChI | InChI=1S/C9H13F2N3O2/c1-6(8(15)16-2)13-5-7-12-3-4-14(7)9(10)11/h3-4,6,9,13H,5H2,1-2H3 |
| InChIKey | DTGFCKFSXNPIJZ-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.22 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |