C33H24FN3O5S2 — CID 6151249
methyl 4-[(3E)-3-[(3-fluoro-4-methylphenyl)-hydroxymethylidene]-1-[5-(naphthalen-1-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]-4,5-dioxopyrrolidin-2-yl]benzoate (PubChem CID 6151249) has the molecular formula C33H24FN3O5S2 and a molecular weight of 625.70 g/mol. Its IUPAC name is methyl 4-[(3E)-3-[(3-fluoro-4-methylphenyl)-hydroxymethylidene]-1-[5-(naphthalen-1-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]-4,5-dioxopyrrolidin-2-yl]benzoate.
| Compound Name | methyl 4-[(3E)-3-[(3-fluoro-4-methylphenyl)-hydroxymethylidene]-1-[5-(naphthalen-1-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]-4,5-dioxopyrrolidin-2-yl]benzoate |
|---|---|
| PubChem CID | 6151249 |
| Molecular Formula | C33H24FN3O5S2 |
| Molecular Weight | 625.70 g/mol |
| Exact Mass | 625.11 |
| IUPAC Name | methyl 4-[(3E)-3-[(3-fluoro-4-methylphenyl)-hydroxymethylidene]-1-[5-(naphthalen-1-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]-4,5-dioxopyrrolidin-2-yl]benzoate |
| SMILES | COC(=O)c1ccc(C2/C(=C(\O)c3ccc(C)c(F)c3)C(=O)C(=O)N2c2nnc(SCc3cccc4ccccc34)s2)cc1 |
| InChI | InChI=1S/C33H24FN3O5S2/c1-18-10-11-22(16-25(18)34)28(38)26-27(20-12-14-21(15-13-20)31(41)42-2)37(30(40)29(26)39)32-35-36-33(44-32)43-17-23-8-5-7-19-6-3-4-9-24(19)23/h3-16,27,38H,17H2,1-2H3/b28-26+ |
| InChIKey | OUIGGBZBUVNNFN-BYCLXTJYSA-N |
| XLogP | 6.84 |
| TPSA | 109.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.70 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|