C38H28FN3O4S2 — CID 6027696
(4E)-4-[(3-fluoro-4-methylphenyl)-hydroxymethylidene]-1-[5-(naphthalen-1-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]-5-(4-phenylmethoxyphenyl)pyrrolidine-2,3-dione (PubChem CID 6027696) has the molecular formula C38H28FN3O4S2 and a molecular weight of 673.79 g/mol. Its IUPAC name is (4E)-4-[(3-fluoro-4-methylphenyl)-hydroxymethylidene]-1-[5-(naphthalen-1-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]-5-(4-phenylmethoxyphenyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[(3-fluoro-4-methylphenyl)-hydroxymethylidene]-1-[5-(naphthalen-1-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]-5-(4-phenylmethoxyphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 6027696 |
| Molecular Formula | C38H28FN3O4S2 |
| Molecular Weight | 673.79 g/mol |
| Exact Mass | 673.15 |
| IUPAC Name | (4E)-4-[(3-fluoro-4-methylphenyl)-hydroxymethylidene]-1-[5-(naphthalen-1-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]-5-(4-phenylmethoxyphenyl)pyrrolidine-2,3-dione |
| SMILES | Cc1ccc(/C(O)=C2\C(=O)C(=O)N(c3nnc(SCc4cccc5ccccc45)s3)C2c2ccc(OCc3ccccc3)cc2)cc1F |
| InChI | InChI=1S/C38H28FN3O4S2/c1-23-14-15-27(20-31(23)39)34(43)32-33(26-16-18-29(19-17-26)46-21-24-8-3-2-4-9-24)42(36(45)35(32)44)37-40-41-38(48-37)47-22-28-12-7-11-25-10-5-6-13-30(25)28/h2-20,33,43H,21-22H2,1H3/b34-32+ |
| InChIKey | GRKKFSXBBNJPJU-NWBJSICCSA-N |
| XLogP | 8.64 |
| TPSA | 92.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.79 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|